Compound Information | SONAR Target prediction | Name: | METHICILLIN SODIUM | Unique Identifier: | SPE01500395 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 383.248 g/mol | X log p: | 5.686 (online calculus) | Lipinksi Failures | 1 | TPSA | 121.27 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 6 | Canonical Smiles: | [Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)c1c(OC)cccc1OC)C2=O | Source: | semisynthetic | Therapeutics: | antibacterial |
Species: |
4932 |
Condition: |
SWC5 |
Replicates: |
2 |
Raw OD Value: r im |
0.6621±0.00388909 |
Normalized OD Score: sc h |
0.9843±0.0113407 |
Z-Score: |
-0.6895±0.443838 |
p-Value: |
0.511454 |
Z-Factor: |
-4.13235 |
Fitness Defect: |
0.6705 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 2|E3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2008-06-19 YYYY-MM-DD | Plate CH Control (+): | 0.039575±0.00026 | Plate DMSO Control (-): | 0.64005±0.01656 | Plate Z-Factor: | 0.9011 |
| png ps pdf |
6917651 |
sodium (5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxyla te hydrate |
6917652 |
(5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxyli c acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 3276 | Additional Members: 16 | Rows returned: 1 | |
|