| Compound Information | SONAR Target prediction | | Name: | METHICILLIN SODIUM | | Unique Identifier: | SPE01500395 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 383.248 g/mol | | X log p: | 5.686 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 121.27 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | [Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)c1c(OC)cccc1OC)C2=O | | Source: | semisynthetic | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
NUP100 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7344±0.00813173 |
| Normalized OD Score: sc h |
0.9747±0.017938 |
| Z-Score: |
-1.7299±1.23809 |
| p-Value: |
0.201024 |
| Z-Factor: |
-3.51531 |
| Fitness Defect: |
1.6043 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 20|H11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.60 Celcius | | Date: | 2007-08-28 YYYY-MM-DD | | Plate CH Control (+): | 0.040825±0.00060 | | Plate DMSO Control (-): | 0.739775±0.01473 | | Plate Z-Factor: | 0.9420 |
|  png
ps
pdf |
| 6917651 |
sodium
(5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxyla
te hydrate |
| 6917652 |
(5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxyli
c acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 3276 | Additional Members: 16 | Rows returned: 1 | |
|
