| 
 | Compound Information | SONAR Target prediction |  | Name: | MEGESTROL ACETATE |  | Unique Identifier: | SPE01500381 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 352.254 g/mol |  | X log p: | 3.249  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CC(=O)OC1(CCC2C3C=C(C)C4=CC(=O)CCC4(C)C3CCC21C)C(C)=O |  | Source: | semisynthetic |  | Therapeutics: | progestogen, antineoplastic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SKT5 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6608±0.00537401 |  
		| Normalized OD Score: sc h | 0.9324±0.00169803 |  
		| Z-Score: | -3.3588±0.0666141 |  
		| p-Value: | 0.000793534 |  
		| Z-Factor: | 0.258875 |  
		| Fitness Defect: | 7.139 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 2|G6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.90 Celcius |  | Date: | 2008-06-17 YYYY-MM-DD |  | Plate CH Control (+): | 0.0405±0.00045 |  | Plate DMSO Control (-): | 0.6874±0.01039 |  | Plate Z-Factor: | 0.9287 | 
 |  png ps
 pdf
 | 
 
 
	
		| 4048 | (17-acetyl-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate
 |  
		| 11683 | [(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[ a]phenanthren-17-yl] acetate
 |  
		| 91668 | [(8R,9R,10R,13S,14S,17R)-17-acetyl-6,13-dimethyl-3-oxo-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]p henanthren-17-yl] acetate
 |  
		| 200136 | [(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]p henanthren-17-yl] acetate
 |  
		| 626483 | (17-acetyl-6,10,13,16-tetramethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl ) acetate
 |  
		| 3839280 | (17-acetyl-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate
 |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 5652 | Additional Members: 7 | Rows returned: 1 |  | 
 
 |