| Compound Information | SONAR Target prediction | | Name: | MEGESTROL ACETATE | | Unique Identifier: | SPE01500381 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 352.254 g/mol | | X log p: | 3.249 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC(=O)OC1(CCC2C3C=C(C)C4=CC(=O)CCC4(C)C3CCC21C)C(C)=O | | Source: | semisynthetic | | Therapeutics: | progestogen, antineoplastic |
| Species: |
4932 |
| Condition: |
BEM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6527±0.00190919 |
| Normalized OD Score: sc h |
0.8585±0.0117167 |
| Z-Score: |
-4.1576±0.278371 |
| p-Value: |
0.0000440206 |
| Z-Factor: |
-0.0484186 |
| Fitness Defect: |
10.0309 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 23|F11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.20 Celcius | | Date: | 2006-03-25 YYYY-MM-DD | | Plate CH Control (+): | 0.042025±0.00175 | | Plate DMSO Control (-): | 0.6377±0.00902 | | Plate Z-Factor: | 0.9444 |
|  png
ps
pdf |
| 7001143 |
[(8S,9S,10R,13S,14S,17S)-17-acetyl-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[
a]phenanthren-17-yl] acetate |
| 7061046 |
[(8S,9S,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]p
henanthren-17-yl] acetate |
| 7075726 |
[(8R,9R,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[
a]phenanthren-17-yl] acetate |
| 7075727 |
[(8S,9R,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[
a]phenanthren-17-yl] acetate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 5652 | Additional Members: 7 | Rows returned: 1 | |
|
