| 
 | Compound Information | SONAR Target prediction |  | Name: | MEDRYSONE |  | Unique Identifier: | SPE01500380 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 312.234 g/mol |  | X log p: | 1.024  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | CC1CC2C3CCC(C(C)=O)C3(C)CC(O)C2C2(C)CCC(=O)C=C12 |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid |  | Generic_name: | Medrysone |  | Chemical_iupac_name: | 17-acetyl-11-hydroxy-6,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocycl openta[a]phenanthren-3-one
 |  | Drug_type: | Approved Drug |  | Pharmgkb_id: | PA450346 |  | Kegg_compound_id: | C14643 |  | Drugbank_id: | APRD01091 |  | Melting_point: | 156.5 oC |  | Logp: | 3.291 |  | Cas_registry_number: | 2668-66-8 |  | Drug_category: | Topical anti-inflammatory Agent; ATC:S01BA08 |  | Indication: | For the treatment of allergic conjunctivitis, vernal conjunctivitis, episcleritis, and epinephrine sensitivity.
 |  | Pharmacology: | Medrysone is a topical anti-inflammatory corticoidsteroids for ophthalmic use. In patients with increased intraocular pressure and in those susceptible to a rise in
 intraocular pressure, there is less effect on pressure with medrysone than with
 dexamethasone or betamethasone. Corticoidsteroids inhibit the edema, fibrin
 deposition, capillary dilation, and phagocytic migration of the acute inflammatory
 response, as well as capillary proliferation, deposition of collagen, and scar
 formation.
 |  | Mechanism_of_action: | There is no generally accepted explanation for the mechanism of action of ocular corticosteroids. However, corticosteroids are thought to act by the induction of
 phospholipase A2 inhibitory proteins, collectively called lipocortins. It is
 postulated that these proteins control the biosynthesis of potent mediators of
 inflammation such as prostaglandins and leukotrienes by inhibiting the release of
 their common precursor, arachidonic acid. Arachidonic acid is released from membrane
 phospholipids by phospholipase A2.
 |  | Organisms_affected: | Humans and other mammals | 
 
 
	
		| Species: | 4932 |  
		| Condition: | PEP5 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6726±0.00551543 |  
		| Normalized OD Score: sc h | 0.9885±0.00294582 |  
		| Z-Score: | -0.6171±0.167933 |  
		| p-Value: | 0.540022 |  
		| Z-Factor: | -3.6138 |  
		| Fitness Defect: | 0.6161 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 18|G6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.60 Celcius |  | Date: | 2008-08-14 YYYY-MM-DD |  | Plate CH Control (+): | 0.0493±0.00186 |  | Plate DMSO Control (-): | 0.6667750000000001±0.01648 |  | Plate Z-Factor: | 0.9287 | 
 |  png ps
 pdf
 | 
 
 
	
		| 6556705 | (8R,9R,10R,11S,13S,14S,16R,17R)-17-acetyl-11-hydroxy-10,13,16,17-tetramethyl-2,6,7,8,9,11,12,14,15,16-de cahydro-1H-cyclopenta[a]phenanthren-3-one
 |  
		| 6571875 | (8R,9S,10S,11S,13S,14R,17S)-17-acetyl-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydr ocyclopenta[a]phenanthren-3-one
 |  
		| 6604310 | (6S,8S,9S,10S,11R,13S,14R,17R)-17-acetyl-11-hydroxy-6,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dode cahydrocyclopenta[a]phenanthren-3-one
 |  
		| 6919040 | (8R,9S,10R,11S,13R,14S,17R)-17-acetyl-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydr ocyclopenta[a]phenanthren-3-one
 |  
		| 6973651 | (8R,9S,10R,11R,13S,14S,17S)-17-acetyl-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydr ocyclopenta[a]phenanthren-3-one
 |  
		| 6976798 | (8R,9R,10R,11S,13R,14R,17R)-17-acetyl-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydr ocyclopenta[a]phenanthren-3-one
 |  
 | internal high similarity DBLink  | Rows returned: 13 | 1 2 3 Next >> | 
 
 | active | Cluster 7623 | Additional Members: 3 | Rows returned: 0 |  | 
 
 |