| 
 | Compound Information | SONAR Target prediction |  | Name: | MEDROXYPROGESTERONE ACETATE |  | Unique Identifier: | SPE01500379 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 352.254 g/mol |  | X log p: | 1.176  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CC1CC2C(CCC3(C)C2CCC3(OC(C)=O)C(C)=O)C2(C)CCC(=O)C=C12 |  | Source: | semisynthetic |  | Therapeutics: | contraceptive | 
 
 
	
		| Species: | 4932 |  
		| Condition: | MSN5 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6565±0.0000707107 |  
		| Normalized OD Score: sc h | 0.9711±0.000401737 |  
		| Z-Score: | -1.4099±0.0537819 |  
		| p-Value: | 0.158859 |  
		| Z-Factor: | -1.42865 |  
		| Fitness Defect: | 1.8397 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 18|G5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.70 Celcius |  | Date: | 2008-02-29 YYYY-MM-DD |  | Plate CH Control (+): | 0.041550000000000004±0.00141 |  | Plate DMSO Control (-): | 0.655575±0.01528 |  | Plate Z-Factor: | 0.9186 | 
 |  png ps
 pdf
 | 
 
 
	
		| 3001 | [2-(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxo- ethyl] acetate
 |  
		| 4042 | (17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate
 |  
		| 5952 | [2-[(8S,9S,10R,13R,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]p henanthren-17-yl]-2-oxo-ethyl] acetate
 |  
		| 6279 | [(6S,8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cycl openta[a]phenanthren-17-yl] acetate
 |  
		| 9325 | [(9S,14S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanth ren-17-yl] acetate
 |  
		| 32789 | [(9S,11S,14S,17R)-17-acetyl-11,13-dimethyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]p henanthren-17-yl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 2 |  | 
 
 | active | Cluster 18089 | Additional Members: 2 | Rows returned: 0 |  | 
 
 |