| Compound Information | SONAR Target prediction | | Name: | MEDROXYPROGESTERONE ACETATE | | Unique Identifier: | SPE01500379 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 352.254 g/mol | | X log p: | 1.176 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC1CC2C(CCC3(C)C2CCC3(OC(C)=O)C(C)=O)C2(C)CCC(=O)C=C12 | | Source: | semisynthetic | | Therapeutics: | contraceptive |
| Species: |
4932 |
| Condition: |
CDC73 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3472±0.000848528 |
| Normalized OD Score: sc h |
0.8288±0.0347971 |
| Z-Score: |
-4.3410±1.10421 |
| p-Value: |
0.00018547 |
| Z-Factor: |
-1.9232 |
| Fitness Defect: |
8.5926 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 12|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.80 Celcius | | Date: | 2007-09-19 YYYY-MM-DD | | Plate CH Control (+): | 0.0405±0.00081 | | Plate DMSO Control (-): | 0.41395000000000004±0.04383 | | Plate Z-Factor: | 0.5966 |
| png ps pdf |
| 11875276 |
[(8R,9R,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta [a]phenanthren-17-yl] acetate |
| 11875277 |
[(8R,9S,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta [a]phenanthren-17-yl] acetate |
| internal high similarity DBLink | Rows returned: 2 | |
| nonactive | Cluster 18089 | Additional Members: 2 | Rows returned: 1 | |
|