Compound Information | SONAR Target prediction | Name: | MEDROXYPROGESTERONE ACETATE | Unique Identifier: | SPE01500379 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.254 g/mol | X log p: | 1.176 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC1CC2C(CCC3(C)C2CCC3(OC(C)=O)C(C)=O)C2(C)CCC(=O)C=C12 | Source: | semisynthetic | Therapeutics: | contraceptive |
Species: |
4932 |
Condition: |
CDC73 |
Replicates: |
2 |
Raw OD Value: r im |
0.3472±0.000848528 |
Normalized OD Score: sc h |
0.8288±0.0347971 |
Z-Score: |
-4.3410±1.10421 |
p-Value: |
0.00018547 |
Z-Factor: |
-1.9232 |
Fitness Defect: |
8.5926 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 12|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.80 Celcius | Date: | 2007-09-19 YYYY-MM-DD | Plate CH Control (+): | 0.0405±0.00081 | Plate DMSO Control (-): | 0.41395000000000004±0.04383 | Plate Z-Factor: | 0.5966 |
| png ps pdf |
6977847 |
[(6R,8S,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
7001303 |
[(8S,9R,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta [a]phenanthren-17-yl] acetate |
7001304 |
[(8S,9R,10R,13S,14R,17S)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta [a]phenanthren-17-yl] acetate |
7001305 |
[(8S,9S,10R,13S,14R,17S)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta [a]phenanthren-17-yl] acetate |
7048585 |
[(6S,8R,9S,10R,13S,14R,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
7061018 |
[(8S,9S,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta [a]phenanthren-17-yl] acetate |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 18089 | Additional Members: 2 | Rows returned: 0 | |
|