| Compound Information | SONAR Target prediction | | Name: | MEDROXYPROGESTERONE ACETATE | | Unique Identifier: | SPE01500379 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 352.254 g/mol | | X log p: | 1.176 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC1CC2C(CCC3(C)C2CCC3(OC(C)=O)C(C)=O)C2(C)CCC(=O)C=C12 | | Source: | semisynthetic | | Therapeutics: | contraceptive |
| Species: |
4932 |
| Condition: |
CHS7 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4772±0.000424264 |
| Normalized OD Score: sc h |
0.8410±0.00770674 |
| Z-Score: |
-5.1210±0.663079 |
| p-Value: |
0.00000165378 |
| Z-Factor: |
-0.370322 |
| Fitness Defect: |
13.3124 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 18|G5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.10 Celcius | | Date: | 2008-02-21 YYYY-MM-DD | | Plate CH Control (+): | 0.0408±0.00054 | | Plate DMSO Control (-): | 0.536125±0.03127 | | Plate Z-Factor: | 0.8183 |
|  png
ps
pdf |
| 62992 |
[(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclope
nta[a]phenanthren-17-yl] acetate |
| 86543 |
(17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)
acetate |
| 134963 |
[(8R,9S,10R,13S,14S,17R)-17-acetyl-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a
]phenanthren-17-yl] acetate |
| 229869 |
[2-(2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicen-2-yl)-2-ox
o-ethyl] acetate |
| 241767 |
[(8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-17-propanoyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclope
nta[a]phenanthren-17-yl] acetate |
| 266116 |
(17-acetyl-4,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)
acetate |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 18089 | Additional Members: 2 | Rows returned: 0 | |
|
