| Compound Information | SONAR Target prediction |
| Name: | MECLOFENAMATE SODIUM |
| Unique Identifier: | SPE01500377 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 308.051 g/mol |
| X log p: | 13.048 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 40.13 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | [Na+].[O-]C(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl |
| Source: | synthetic |
| Therapeutics: | antiinflammatory, antipyretic |
| Generic_name: | Meclofenamate |
| Chemical_iupac_name: | 2-[(2,6-dichloro-3-methyl-phenyl)amino]benzoic acid |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA450341 |
| Kegg_compound_id: | C02996 |
| Drugbank_id: | APRD01090 |
| Melting_point: | 257 oC |
| H2o_solubility: | 30 mg/L |
| Logp: | 4.998 |
| Cas_registry_number: | 644-62-2 |
| Drug_category: | Anti-Inflammatory Agents, Non-Steroidal; Cyclooxygenase Inhibitors; ATC:M01AG04; ATC:M02AA18 |
| Indication: | For the relief of mild to moderate pain, for the treatment of primary dysmenorrhea and for the treatment of idiopathic heavy menstrual blood loss. Also for relief of the signs and symptoms of acute and chronic rheumatoid arthritis and osteoarthritis. |
| Pharmacology: | Meclofenamate is a nonsteroidal agent which has demonstrated anti-inflammatory, analgesic, and antipyretic activity in laboratory animals. |
| Mechanism_of_action: | The mode of action, like that of other nonsteroidal anti-inflammatory agents, is not known. Therapeutic action does not result from pituitary-adrenal stimulation. In animal studies, meclofenamate was found to inhibit prostaglandin synthesis and to compete for binding at the prostaglandin receptor site. In vitro meclofenamate was found to be an inhibitor of human leukocyte 5-lipoxygenase activity. These properties may be responsible for the anti-inflammatory action of meclofenamate. There is no evidence that meclofenamate sodium alters the course of the underlying disease. |
| Organisms_affected: | Humans and other mammals |
| Found: 305 active | as graph: single | with analogs | [1] << Back 21 22 23 24 25 26 27 28 29 30 Next >> [305] |
| Species: | 4932 |
| Condition: | SPE00200033 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.3891±0 |
| Normalized OD Score: sc h | 0.5624±0 |
| Z-Score: | -13.0685±0 |
| p-Value: | 4.98312e-39 |
| Z-Factor: | 0.663009 |
| Fitness Defect: | 88.1948 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 5 |
| 4036 | 2-[(2,6-dichloro-3-methyl-phenyl)amino]benzoate |
| 4037 | 2-[(2,6-dichloro-3-methyl-phenyl)amino]benzoic acid |
| 4038 | sodium 2-[(2,6-dichloro-3-methyl-phenyl)amino]benzoate |
| 22881 | sodium 2-[(2,6-dichloro-3-methyl-phenyl)amino]benzoate |
| 5282369 | sodium 2-[(2,6-dichloro-3-methyl-phenyl)amino]benzoate hydrate |
| internal high similarity DBLink | Rows returned: 1 |
| LOPAC 01048 | 1.0000 |
| active | Cluster 15311 | Additional Members: 3 | Rows returned: 1 |
| LOPAC 01048 | 0 |
Service provided by the
Mike Tyers Laboratory