Compound Information | SONAR Target prediction | Name: | ISOSORBIDE DINITRATE | Unique Identifier: | SPE01500358 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 228.073 g/mol | X log p: | 1.018 (online calculus) | Lipinksi Failures | 0 | TPSA | 123.2 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 4 | Canonical Smiles: | [O-][N+](=O)OC1COC2C(COC12)O[N+]([O-])=O | Source: | synthetic | Therapeutics: | antianginal | Generic_name: | Isosorbide Dinitrate | Chemical_iupac_name: | 4,8-dinitrooxy-2,6-dioxabicyclo[3.3.0]octane | Drug_type: | Approved Drug | Pharmgkb_id: | PA450125 | Kegg_compound_id: | C07456 | Drugbank_id: | APRD00455 | Melting_point: | 70 oC | H2o_solubility: | 1.089 mg/mL | Logp: | -0.53 | Cas_registry_number: | 87-33-2 | Drug_category: | Vasodilator Agents; Nitrates and Nitrites; ATC:C01DA08; ATC:D03AX08 | Indication: | For the prevention of angina pectoris due to coronary artery disease. | Pharmacology: | Isosorbide Dinitrate is a moderate to long acting oral organic nitrate used for the relief and prophylactic management of angina pectoris. It relaxes the vascular smooth muscle and consequent dilatation of peripheral arteries and veins, especially the latter. Dilatation of the veins promotes peripheral pooling of blood and decreases venous return to the heart, thereby reducing left ventricular end- diastolic pressure and pulmonary capillary wedge pressure (preload). Arteriolar relaxation reduces systemic vascular resistance, systolic arterial pressure, and mean arterial pressure. | Mechanism_of_action: | Similar to other nitrites and organic nitrates, isosorbide dinitrate is converted to nitric oxide (NO), an active intermediate compound which activates the enzyme guanylate cyclase (atrial natriuretic peptide receptor A). This stimulates the synthesis of cyclic guanosine 3-,5--monophosphate (cGMP) which then activates a series of protein kinase-dependent phosphorylations in the smooth muscle cells, eventually resulting in the dephosphorylation of the myosin light chain of the smooth muscle fiber. The subsequent release of calcium ions results in the relaxation of the smooth muscle cells and vasodilation. | Organisms_affected: | Humans and other mammals |
Species: |
4932 |
Condition: |
QCR8 |
Replicates: |
2 |
Raw OD Value: r im |
0.6384±0.00339411 |
Normalized OD Score: sc h |
0.9838±0.000848415 |
Z-Score: |
-0.6706±0.0351918 |
p-Value: |
0.502598 |
Z-Factor: |
-2.68922 |
Fitness Defect: |
0.688 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 18|F6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2008-04-25 YYYY-MM-DD | Plate CH Control (+): | 0.039775000000000005±0.00092 | Plate DMSO Control (-): | 0.63915±0.01446 | Plate Z-Factor: | 0.9351 |
| png ps pdf |
3780 |
(2-nitrooxy-4,8-dioxabicyclo[3.3.0]oct-6-yl) nitrate |
6883 |
[(1R,2S,5R,6R)-2-nitrooxy-4,8-dioxabicyclo[3.3.0]oct-6-yl] nitrate |
27661 |
[(1R,2R,5R,6S)-6-hydroxy-4,8-dioxabicyclo[3.3.0]oct-2-yl] nitrate |
62989 |
[(1R,2S,5R,6R)-6-hydroxy-4,8-dioxabicyclo[3.3.0]oct-2-yl] nitrate |
170113 |
[(1S,2R,5S,6R)-6-nitrooxy-4,8-dioxabicyclo[3.3.0]oct-2-yl] nitrate |
181094 |
[(1R,2S,5R,6S)-6-hydroxy-4,8-dioxabicyclo[3.3.0]oct-2-yl] nitrate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 568 | Additional Members: 2 | Rows returned: 0 | |
|