| Compound Information | SONAR Target prediction | | Name: | HYDROCORTISONE PHOSPHATE TRIETHYLAMINE | | Unique Identifier: | SPE01500340 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 457.173 g/mol | | X log p: | -2.384 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 116.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | [Na+].[Na+].[O-]P([O-])(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)C C21C | | Source: | semisynthetic | | Therapeutics: | glucocorticoid |
| Species: |
4932 |
| Condition: |
COT1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7059±0.00268701 |
| Normalized OD Score: sc h |
1.0117±0.00438779 |
| Z-Score: |
0.6051±0.219734 |
| p-Value: |
0.549928 |
| Z-Factor: |
-7.59193 |
| Fitness Defect: |
0.598 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 12|E6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.40 Celcius | | Date: | 2007-11-20 YYYY-MM-DD | | Plate CH Control (+): | 0.0402±0.00044 | | Plate DMSO Control (-): | 0.6762999999999999±0.02621 | | Plate Z-Factor: | 0.8719 |
| png ps pdf |
| 3644 |
11,17-dihydroxy-10,13-dimethyl-17-(2-phosphonatooxyacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclope nta[a]phenanthren-3-one |
| 3645 |
[2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren- 17-yl)-2-oxo-ethoxy]phosphonic acid |
| 19738 |
[2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenan thren-17-yl]-2-oxo-ethoxy]phosphonic acid |
| 22319 |
disodium (17R)-11,17-dihydroxy-10,13-dimethyl-17-(2-phosphonatooxyacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-c yclopenta[a]phenanthren-3-one |
| 441406 |
disodium (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-17-(2-phosphonatooxyacetyl)-2,6,7,8,9,11,12,1 4,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| 441407 |
[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro- 1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]phosphonic acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|