Compound Information | SONAR Target prediction | Name: | HYDROCORTISONE PHOSPHATE TRIETHYLAMINE | Unique Identifier: | SPE01500340 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 457.173 g/mol | X log p: | -2.384 (online calculus) | Lipinksi Failures | 0 | TPSA | 116.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 4 | Canonical Smiles: | [Na+].[Na+].[O-]P([O-])(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)C C21C | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4932 |
Condition: |
SKT5 |
Replicates: |
2 |
Raw OD Value: r im |
0.6772±0.014425 |
Normalized OD Score: sc h |
0.9977±0.00016111 |
Z-Score: |
-0.1143±0.00694369 |
p-Value: |
0.908994 |
Z-Factor: |
-28.9274 |
Fitness Defect: |
0.0954 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 18|E5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.10 Celcius | Date: | 2008-06-17 YYYY-MM-DD | Plate CH Control (+): | 0.040825±0.00059 | Plate DMSO Control (-): | 0.666825±0.01883 | Plate Z-Factor: | 0.8832 |
| png ps pdf |
3644 |
11,17-dihydroxy-10,13-dimethyl-17-(2-phosphonatooxyacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclope nta[a]phenanthren-3-one |
3645 |
[2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren- 17-yl)-2-oxo-ethoxy]phosphonic acid |
19738 |
[2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenan thren-17-yl]-2-oxo-ethoxy]phosphonic acid |
22319 |
disodium (17R)-11,17-dihydroxy-10,13-dimethyl-17-(2-phosphonatooxyacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-c yclopenta[a]phenanthren-3-one |
441406 |
disodium (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-17-(2-phosphonatooxyacetyl)-2,6,7,8,9,11,12,1 4,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
441407 |
[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro- 1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]phosphonic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|