Compound Information | SONAR Target prediction | Name: | HYDROCORTISONE PHOSPHATE TRIETHYLAMINE | Unique Identifier: | SPE01500340 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 457.173 g/mol | X log p: | -2.384 (online calculus) | Lipinksi Failures | 0 | TPSA | 116.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 4 | Canonical Smiles: | [Na+].[Na+].[O-]P([O-])(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)C C21C | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4932 |
Condition: |
VAM3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6491±0.020294 |
Normalized OD Score: sc h |
0.9762±0.0128812 |
Z-Score: |
-0.7171±0.358054 |
p-Value: |
0.487306 |
Z-Factor: |
-9.45753 |
Fitness Defect: |
0.7189 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 18|E5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.10 Celcius | Date: | 2008-04-09 YYYY-MM-DD | Plate CH Control (+): | 0.040125±0.00071 | Plate DMSO Control (-): | 0.6247±0.03107 | Plate Z-Factor: | 0.8448 |
| png ps pdf |
5702070 |
disodium (11S,17R)-11,17-dihydroxy-10,13-dimethyl-17-(2-phosphonatooxyacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro- 1H-cyclopenta[a]phenanthren-3-one |
6602442 |
[2-[(11S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]ph enanthren-17-yl]-2-oxo-ethoxy]phosphonic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|