Compound Information | SONAR Target prediction | Name: | HYDROCORTISONE PHOSPHATE TRIETHYLAMINE | Unique Identifier: | SPE01500340 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 457.173 g/mol | X log p: | -2.384 (online calculus) | Lipinksi Failures | 0 | TPSA | 116.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 4 | Canonical Smiles: | [Na+].[Na+].[O-]P([O-])(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)C C21C | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4896 |
Condition: |
MT1181-W303mata |
Replicates: |
2 |
Raw OD Value: r im |
0.4248±0.0125865 |
Normalized OD Score: sc h |
1.0856±0.00471785 |
Z-Score: |
0.8714±0.0553153 |
p-Value: |
0.383912 |
Z-Factor: |
-3.15231 |
Fitness Defect: |
0.9573 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 12|E6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2005-12-14 YYYY-MM-DD | Plate CH Control (+): | 0.383275±0.02715 | Plate DMSO Control (-): | 0.3883±0.02990 | Plate Z-Factor: | -12.8518 |
| png ps pdf |
3644 |
11,17-dihydroxy-10,13-dimethyl-17-(2-phosphonatooxyacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclope nta[a]phenanthren-3-one |
3645 |
[2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren- 17-yl)-2-oxo-ethoxy]phosphonic acid |
19738 |
[2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenan thren-17-yl]-2-oxo-ethoxy]phosphonic acid |
22319 |
disodium (17R)-11,17-dihydroxy-10,13-dimethyl-17-(2-phosphonatooxyacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-c yclopenta[a]phenanthren-3-one |
441406 |
disodium (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-17-(2-phosphonatooxyacetyl)-2,6,7,8,9,11,12,1 4,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
441407 |
[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro- 1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]phosphonic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|