| Compound Information | SONAR Target prediction |  | Name: | HYDROCORTISONE HEMISUCCINATE |  | Unique Identifier: | SPE01500339  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 428.263 g/mol |  | X log p: | -1.51  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 77.51 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CC12CCC(=O)C=C1CCC1C3CCC(O)(C(=O)COC(=O)CCC(O)=O)C3(C)CC(O)C12 |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		BY4741-3rd | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.9000±0.00714178 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9756±0.0138685 | 
	 
	
		| Z-Score: | 
		-0.1851±0.566666 | 
	 
	
		| p-Value: | 
		0.69366 | 
	 
	
		| Z-Factor: | 
		-7330.37 | 
	 
	
		| Fitness Defect: | 
		0.3658 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum_ED |  | Plate Number and Position: | 3|C9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 30.00 Celcius |  | Date: | 2010-08-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.09249999999999999±0.00918 |  | Plate DMSO Control (-): | 0.975±0.02161 |  | Plate Z-Factor: | 0.9306 |  
  |  png ps pdf |  
 
 
	
		| 3643 | 
		4-[2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthre n-17-yl)-2-oxo-ethoxy]-4-oxo-butanoic acid | 
	 
	
		| 16623 | 
		4-[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid | 
	 
	
		| 31314 | 
		sodium 4-[2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthre n-17-yl)-2-oxo-ethoxy]-4-oxo-butanoate | 
	 
	
		| 219121 | 
		4-[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid hydrate | 
	 
	
		| 246168 | 
		4-[2-[(8R,10S,11R,13R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclop enta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid | 
	 
	
		| 441408 | 
		sodium 4-[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 5 |  |   
 
 
 |