Compound Information | SONAR Target prediction | Name: | HYDROCORTISONE HEMISUCCINATE | Unique Identifier: | SPE01500339 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 428.263 g/mol | X log p: | -1.51 (online calculus) | Lipinksi Failures | 0 | TPSA | 77.51 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC12CCC(=O)C=C1CCC1C3CCC(O)(C(=O)COC(=O)CCC(O)=O)C3(C)CC(O)C12 | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4932 |
Condition: |
BIK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6692±0.00169706 |
Normalized OD Score: sc h |
0.9992±0.00473939 |
Z-Score: |
-0.0325±0.207399 |
p-Value: |
0.883466 |
Z-Factor: |
-17.2437 |
Fitness Defect: |
0.1239 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 12|E5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2007-11-08 YYYY-MM-DD | Plate CH Control (+): | 0.040249999999999994±0.00084 | Plate DMSO Control (-): | 0.65735±0.01838 | Plate Z-Factor: | 0.9096 |
| png ps pdf |
7060957 |
4-[2-[(8S,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
7060958 |
4-[2-[(8S,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
7060959 |
4-[2-[(8R,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
7060960 |
4-[2-[(8R,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
16051983 |
sodium 4-[[(8R,9R,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14, 15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-4-oxo-butanoate |
16051984 |
4-[[(8R,9R,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14, 15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-4-oxo-butanoic acid |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|