Compound Information | SONAR Target prediction | Name: | HYDROCORTISONE HEMISUCCINATE | Unique Identifier: | SPE01500339 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 428.263 g/mol | X log p: | -1.51 (online calculus) | Lipinksi Failures | 0 | TPSA | 77.51 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC12CCC(=O)C=C1CCC1C3CCC(O)(C(=O)COC(=O)CCC(O)=O)C3(C)CC(O)C12 | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4932 |
Condition: |
KAR3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6493±0.0066468 |
Normalized OD Score: sc h |
1.0085±0.0000472586 |
Z-Score: |
0.3967±0.00874597 |
p-Value: |
0.691574 |
Z-Factor: |
-26.3938 |
Fitness Defect: |
0.3688 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 12|E5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.50 Celcius | Date: | 2007-09-06 YYYY-MM-DD | Plate CH Control (+): | 0.0408±0.00056 | Plate DMSO Control (-): | 0.6145±0.02092 | Plate Z-Factor: | 0.8779 |
| png ps pdf |
6604111 |
sodium 4-[2-[(8S,9S,10S,11R,13R,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
6604112 |
4-[2-[(8S,9S,10S,11R,13R,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
7060953 |
4-[2-[(8S,9R,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
7060954 |
4-[2-[(8S,9R,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
7060955 |
4-[2-[(8R,9R,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
7060956 |
4-[2-[(8R,9R,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|