| 
 | Compound Information | SONAR Target prediction |  | Name: | HYDROCORTISONE ACETATE |  | Unique Identifier: | SPE01500338 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 372.242 g/mol |  | X log p: | -0.682  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid, antiinflammatory | 
 
 
	
		| Species: | 4932 |  
		| Condition: | COT1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6962±0.00558614 |  
		| Normalized OD Score: sc h | 0.9952±0.00986016 |  
		| Z-Score: | -0.2514±0.514308 |  
		| p-Value: | 0.724556 |  
		| Z-Factor: | -101.624 |  
		| Fitness Defect: | 0.3222 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 12|E4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.40 Celcius |  | Date: | 2007-11-20 YYYY-MM-DD |  | Plate CH Control (+): | 0.0402±0.00044 |  | Plate DMSO Control (-): | 0.6762999999999999±0.02621 |  | Plate Z-Factor: | 0.8719 | 
 |  png ps
 pdf
 | 
 
 
	
		| 3641 | [2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren- 17-yl)-2-oxo-ethyl] acetate
 |  
		| 5744 | [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro- 1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
		| 102056 | [2-[(8S,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro- 1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
		| 105029 | [2-[(8S,9S,10R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-c yclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
		| 223250 | [2-[(2R,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-2,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-deca hydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
		| 227848 | [2-[(6S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-deca hydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 7 | << Back 1 2 | 
 
 | active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 |  | 
 
 |