Compound Information | SONAR Target prediction | Name: | HYDROCORTISONE ACETATE | Unique Identifier: | SPE01500338 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 372.242 g/mol | X log p: | -0.682 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C | Source: | semisynthetic | Therapeutics: | glucocorticoid, antiinflammatory |
Species: |
4932 |
Condition: |
IDH2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5731±0.00155563 |
Normalized OD Score: sc h |
0.9939±0.00119027 |
Z-Score: |
-0.3050±0.0670874 |
p-Value: |
0.760636 |
Z-Factor: |
-8.93593 |
Fitness Defect: |
0.2736 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 12|E4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2007-10-19 YYYY-MM-DD | Plate CH Control (+): | 0.04045±0.00021 | Plate DMSO Control (-): | 0.56505±0.01233 | Plate Z-Factor: | 0.9282 |
| png ps pdf |
7093122 |
[2-[(8R,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro- 1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7093500 |
[2-[(6S,8S,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-deca hydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7213561 |
[2-[(5R,8S,9S,10S,11R,13S,14R,16R,17R)-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-5,6,7,8,9,11,12,14,15,16 -decahydro-4H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7213562 |
[2-[(5R,8S,9S,10S,11R,13S,14S,16R,17R)-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-5,6,7,8,9,11,12,14,15,16 -decahydro-4H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7213564 |
[2-[(5R,8R,9S,10S,11R,13S,14R,16R,17R)-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-5,6,7,8,9,11,12,14,15,16 -decahydro-4H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7213565 |
[2-[(5R,8R,9S,10S,11R,13S,14S,16R,17R)-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-5,6,7,8,9,11,12,14,15,16 -decahydro-4H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|