| Compound Information | SONAR Target prediction | | Name: | HYDROCORTISONE ACETATE | | Unique Identifier: | SPE01500338 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 372.242 g/mol | | X log p: | -0.682 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C | | Source: | semisynthetic | | Therapeutics: | glucocorticoid, antiinflammatory |
| Species: |
4932 |
| Condition: |
DCG1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6871±0.000353553 |
| Normalized OD Score: sc h |
1.0014±0.00428593 |
| Z-Score: |
0.0809±0.237147 |
| p-Value: |
0.86726 |
| Z-Factor: |
-20.7796 |
| Fitness Defect: |
0.1424 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 12|E4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.40 Celcius | | Date: | 2007-10-25 YYYY-MM-DD | | Plate CH Control (+): | 0.0401±0.00061 | | Plate DMSO Control (-): | 0.6769499999999999±0.01976 | | Plate Z-Factor: | 0.9059 |
| png ps pdf |
| 247836 |
[2-[(7S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-7,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-deca hydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 2825532 |
[2-[(11R,16R,17R)-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclope nta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 3554817 |
[2-(11,17-dihydroxy-10,13,16-trimethyl-3-oxo-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanth ren-17-yl)-2-oxo-ethyl] acetate |
| 4266956 |
[2-(11,17-dihydroxy-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthr en-17-yl)-2-oxo-ethyl] acetate |
| 5162669 |
[2-(11,17-dihydroxy-2,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthr en-17-yl)-2-oxo-ethyl] acetate |
| 5224701 |
[2-(11,17-dihydroxy-7,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthr en-17-yl)-2-oxo-ethyl] acetate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|