| Compound Information | SONAR Target prediction |
| Name: | HETACILLIN POTASSIUM |
| Unique Identifier: | SPE01500327 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 405.385 g/mol |
| X log p: | 8.707 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 106.05 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | [K+].[O-]C(=O)C1N2C(SC1(C)C)C(N1C(=O)C(NC1(C)C)c1ccccc1)C2=O |
| Source: | semisynthetic |
| Therapeutics: | antibacterial |
| Generic_name: | Hetacillin |
| Chemical_iupac_name: | 7-(2,2-dimethyl-5-oxo-4-phenyl-imidazolidin-1-yl)-3,3-dimethyl-6-oxo-2-thia-5-azabic yclo[3.2.0]heptane-4-carboxylic acid |
| Drug_type: | Approved Drug |
| Kegg_compound_id: | C11729 |
| Drugbank_id: | APRD01012 |
| Melting_point: | 190 oC |
| Logp: | 1.856 |
| Cas_registry_number: | 3511-16-8 |
| Drug_category: | Anti-bacterial Agents; Penicillins; ATC:J01CA18 |
| Pharmacology: | Hetacillin is a penicillin beta-lactam antibiotic used in the treatment of bacterial infections caused by susceptible, usually gram-positive, organisms. The name "penicillin" can either refer to several variants of penicillin available, or to the group of antibiotics derived from the penicillins. Hetacillin has in vitro activity against gram-positive and gram-negative aerobic and anaerobic bacteria. The bactericidal activity of Hetacillin results from the inhibition of cell wall synthesis and is mediated through Hetacillin binding to penicillin binding proteins (PBPs). |
| Mechanism_of_action: | Hetacillin is a semisynthetic penicillin prodrug which itself has no antibacterial activity, but is converted in the body to ampicillin and has actions and uses similar to those of ampicillin. Hetacillin is prepared by reacting ampicillin with acetone. Ampicillin rapidly decomposes because of the intramolecular attack of the side chain amino group on the lactam ring. Hetacillin locks up the offending amino group and prevents the decompolsition Hetacillin, once hydrolyzed to ampicillin (and acetone) binds to the penicillin binding proteins found in susceptible bacteria. This inhibits the third and last stage of bacterial cell wall synthesis. Cell lysis is then mediated by bacterial cell wall autolytic enzymes such as autolysins |
| Organisms_affected: | Enteric bacteria and other eubacteria |
| Found: 205 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [205] |
| Species: | 4932 |
| Condition: | BCK1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8845±0.0353553 |
| Normalized OD Score: sc h | 0.9956±0.00546572 |
| Z-Score: | 0.3770±0.113476 |
| p-Value: | 0.707108 |
| Z-Factor: | -2.24219 |
| Fitness Defect: | 0.3466 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 10 | 1 2 Next >> |
| 3595 | 6-(2,2-dimethyl-5-oxo-4-phenyl-imidazolidin-1-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2 -carboxylate |
| 3596 | 6-(2,2-dimethyl-5-oxo-4-phenyl-imidazolidin-1-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2 -carboxylic acid |
| 19967 | potassium 6-(2,2-dimethyl-5-oxo-4-phenyl-imidazolidin-1-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2 -carboxylate |
| 68632 | potassium (2S,5R)-6-[(4R)-2,2-dimethyl-5-oxo-4-phenyl-imidazolidin-1-yl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3. 2.0]heptane-2-carboxylate |
| 68633 | (2S,5R)-6-[(4R)-2,2-dimethyl-5-oxo-4-phenyl-imidazolidin-1-yl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3. 2.0]heptane-2-carboxylic acid |
| 108240 | sodium 6-(2,2-dimethyl-5-oxo-4-phenyl-imidazolidin-1-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2 -carboxylate |
| internal high similarity DBLink | Rows returned: 2 |
| SPE01503101 | 0.9251 |
| SPE01500489 | 0.9402 |
| active | Cluster 13186 | Additional Members: 1 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory