| Compound Information | SONAR Target prediction | 
| Name: | FLUOCINONIDE | 
| Unique Identifier: | SPE01500303  | 
| MolClass: |  Checkout models in ver1.5 and ver1.0 | 
| Molecular Formula: |  | 
| Molecular Weight: | 462.271 g/mol | 
| X log p: | 4.713  (online calculus) | 
| Lipinksi Failures | 0 | 
| TPSA | 78.9 | 
| Hydrogen Bond Donor Count: | 0 | 
| Hydrogen Bond Acceptors Count: | 7 | 
| Rotatable Bond Count: | 4 | 
| Canonical Smiles: | CC(=O)OCC(=O)C12OC(C)(C)OC1CC1C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC12C | 
| Source: | semisynthetic | 
| Therapeutics: | antiinflammatory, glucocorticoid | 
| Generic_name: | Fluocinonide | 
| Drug_type: | Approved Drug | 
| Pharmgkb_id: | PA449664 | 
| Kegg_compound_id: | D00325 | 
| Drugbank_id: | APRD00978 | 
| Melting_point: | 309 oC | 
| H2o_solubility: | 4.74 mg/L | 
| Logp: | 2.734 | 
| Cas_registry_number: | 12/07/356 | 
| Drug_category: | Anti-Allergic Agents; Anti-Inflammatory Agents; Glucocorticoids; ATC:C05AA11; ATC:D07AC08 | 
| Indication: | A topical anti-inflammatory product for the relief of the inflammatory and pruritic manifestations of corticosteroid-responsive dermatoses. | 
| Organisms_affected: | Humans and other mammals |