| Compound Information | SONAR Target prediction |
| Name: | FLUOCINOLONE ACETONIDE |
| Unique Identifier: | SPE01500302 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 422.25 g/mol |
| X log p: | 4.24 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 52.6 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | CC1(C)OC2CC3C4CC(F)C5=CC(=O)C=CC5(C)C4(F)C(O)CC3(C)C2(O1)C(=O)CO |
| Source: | semisynthetic |
| Therapeutics: | glucocorticoid, antiinflammatory |
| Generic_name: | Fluocinolone Acetonide |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA449663 |
| Kegg_compound_id: | D01825 |
| Drugbank_id: | APRD00977 |
| Melting_point: | 265-266 oC |
| H2o_solubility: | 11 mg/L |
| Logp: | 2.698 |
| Cas_registry_number: | 67-73-2 |
| Drug_category: | Anti-Inflammatory Agents; Glucocorticoids; Antipruritics; ATC:C05AA10; ATC:D07AC04 |
| Indication: | For the relief of the inflammatory and pruritic manifestations of
corticosteroid-responsive dermatoses. For the treatment of chronic non-infectious
uveitis affecting the posterior segment of the eye (Retisert). |
| Organisms_affected: | Humans and other mammals |
