| Compound Information | SONAR Target prediction |  | Name: | FLUDROCORTISONE ACETATE |  | Unique Identifier: | SPE01500299  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 391.241 g/mol |  | X log p: | -0.363  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3(F)C(O)CC21C |  | Source: | semisynthetic |  | Therapeutics: | mineralocorticoid |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SSE1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4118±0.00275772 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0247±0.0261964 | 
	 
	
		| Z-Score: | 
		0.6365±0.670649 | 
	 
	
		| p-Value: | 
		0.568884 | 
	 
	
		| Z-Factor: | 
		-6.76848 | 
	 
	
		| Fitness Defect: | 
		0.5641 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 18|C4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.90 Celcius |  | Date: | 2008-05-01 YYYY-MM-DD |  | Plate CH Control (+): | 0.040900000000000006±0.00173 |  | Plate DMSO Control (-): | 0.393625±0.01550 |  | Plate Z-Factor: | 0.8808 |  
  |  png ps pdf |  
 
 
	
		| 3370 | 
		[2-(9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenant hren-17-yl)-2-oxo-ethyl] acetate | 
	 
	
		| 10572 | 
		[2-[(9R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]ph enanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 31719 | 
		[2-[(2S,8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-2,10,13-trimethyl-3-oxo-1,2,6,7,8,11,12,14,1 5,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 102142 | 
		[2-[(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-1,2,6,7,8,11,12,14 ,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 224247 | 
		[2-[(2R,8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-2,10,13-trimethyl-3-oxo-1,2,6,7,8,11,12,14,1 5,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 225609 | 
		[2-[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-d ecahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 2 |  |   
 |  nonactive | Cluster 13203 | Additional Members: 4 | Rows returned: 2 |  |   
 
 |