| Compound Information | SONAR Target prediction |
| Name: | FLUDROCORTISONE ACETATE |
| Unique Identifier: | SPE01500299 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 391.241 g/mol |
| X log p: | -0.363 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 60.44 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3(F)C(O)CC21C |
| Source: | semisynthetic |
| Therapeutics: | mineralocorticoid |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 101 102 103 104 105 106 107 108 109 110 Next >> [205] |
| Species: | 4932 |
| Condition: | TFP1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7285±0.00608112 |
| Normalized OD Score: sc h | 0.9954±0.00973822 |
| Z-Score: | -0.1960±0.410087 |
| p-Value: | 0.776054 |
| Z-Factor: | -21.574 |
| Fitness Defect: | 0.2535 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 13 | << Back 1 2 3 |
| 6957656 | [2-[(8R,9R,10R,11R,13S,14S,17S)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-d ecahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| internal high similarity DBLink | Rows returned: 2 |
| SPE01500231 | 0.9072 |
| NRB 03816 | 0.9341 |
| active | Cluster 13203 | Additional Members: 4 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory