Compound Information | SONAR Target prediction | Name: | FLUDROCORTISONE ACETATE | Unique Identifier: | SPE01500299 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 391.241 g/mol | X log p: | -0.363 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3(F)C(O)CC21C | Source: | semisynthetic | Therapeutics: | mineralocorticoid |
Species: |
4932 |
Condition: |
IRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7144±0.00685894 |
Normalized OD Score: sc h |
1.0018±0.0118759 |
Z-Score: |
0.4767±0.653234 |
p-Value: |
0.668052 |
Z-Factor: |
-7.23019 |
Fitness Defect: |
0.4034 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 12|B4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2007-11-23 YYYY-MM-DD | Plate CH Control (+): | 0.039999999999999994±0.00090 | Plate DMSO Control (-): | 0.6981±0.03360 | Plate Z-Factor: | 0.7862 |
| png ps pdf |
5144128 |
[2-(9-fluoro-11,17-dihydroxy-2,10,13-trimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phen anthren-17-yl)-2-oxo-ethyl] acetate |
5702054 |
[2-[(9R,11S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyc lopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
6426826 |
[2-[(9R,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[ a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
6546944 |
[2-[(8S,9S,10S,11R,13R,14S,17S)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-d ecahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
6604260 |
[2-[(8R,9S,10S,11S,13S,14R,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-d ecahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
6710659 |
[2-[(9R,10S,11S,13S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydr ocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 13203 | Additional Members: 4 | Rows returned: 0 | |
|