| Compound Information | SONAR Target prediction |  | Name: | ESTRIOL |  | Unique Identifier: | SPE01500285  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 264.191 g/mol |  | X log p: | 6.586  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC12CCC3C(CCc4cc(O)ccc34)C1CC(O)C2O |  | Class: | sterol |  | Source: | mammalian hormone |  | Reference: | JACS 76:2943 (1954); Biochem Prep 12:81 (1968); J Steroid Biochem 20:945 (1984) |  | Therapeutics: | estrogen |  | Generic_name: | 1,3,5(10)-ESTRATRIENE-3,16,17-TRIOL |  | Chemical_iupac_name: | ESTRIOL |  | Drug_type: | Experimental |  | Kegg_compound_id: | C05141 |  | Drugbank_id: | EXPT01361 |  | Logp: | 2.337 |  | Cas_registry_number: | 50-27-1 |  | Drug_category: | Cytochrome P450 51 inhibitor |  | Organisms_affected: | -1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		NUM1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7126±0.0100409 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9894±0.00331786 | 
	 
	
		| Z-Score: | 
		-0.4698±0.138789 | 
	 
	
		| p-Value: | 
		0.640144 | 
	 
	
		| Z-Factor: | 
		-3.39751 | 
	 
	
		| Fitness Defect: | 
		0.4461 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 12|A9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.90 Celcius |  | Date: | 2006-02-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.0398±0.00085 |  | Plate DMSO Control (-): | 0.6976249999999999±0.00760 |  | Plate Z-Factor: | 0.9629 |  
  |  png ps pdf |  
 
 
	
		| 3269 | 
		13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol | 
	 
	
		| 5756 | 
		(8S,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol | 
	 
	
		| 27067 | 
		(16R)-13-ethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol | 
	 
	
		| 68929 | 
		(8S,9S,13S,14S,16S,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol | 
	 
	
		| 197991 | 
		(8S,9S,14S,16R,17R)-13-ethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol | 
	 
	
		| 256737 | 
		(8S,9S,13S,14S,16R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 13982 | Additional Members: 12 | Rows returned: 4 |  |   
 
 |