| 
 | Compound Information | SONAR Target prediction |  | Name: | ESTRIOL |  | Unique Identifier: | SPE01500285 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 264.191 g/mol |  | X log p: | 6.586  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC12CCC3C(CCc4cc(O)ccc34)C1CC(O)C2O |  | Class: | sterol |  | Source: | mammalian hormone |  | Reference: | JACS 76:2943 (1954); Biochem Prep 12:81 (1968); J Steroid Biochem 20:945 (1984) |  | Therapeutics: | estrogen |  | Generic_name: | 1,3,5(10)-ESTRATRIENE-3,16,17-TRIOL |  | Chemical_iupac_name: | ESTRIOL |  | Drug_type: | Experimental |  | Kegg_compound_id: | C05141 |  | Drugbank_id: | EXPT01361 |  | Logp: | 2.337 |  | Cas_registry_number: | 50-27-1 |  | Drug_category: | Cytochrome P450 51 inhibitor |  | Organisms_affected: | -1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BNI1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6836±0.00565685 |  
		| Normalized OD Score: sc h | 0.9906±0.00149249 |  
		| Z-Score: | -0.4646±0.0883212 |  
		| p-Value: | 0.642868 |  
		| Z-Factor: | -14.9001 |  
		| Fitness Defect: | 0.4418 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 12|A9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.20 Celcius |  | Date: | 2007-09-14 YYYY-MM-DD |  | Plate CH Control (+): | 0.041800000000000004±0.00065 |  | Plate DMSO Control (-): | 0.6683±0.02422 |  | Plate Z-Factor: | 0.8707 | 
 |  png ps
 pdf
 | 
 
 
	
		| 6955452 | (8S,9S,13R,14S,16R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol
 |  
		| 7048596 | (8R,9S,13S,14R,16R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol
 |  
		| 7060905 | (8R,9S,13S,14R,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol
 |  
		| 15967764 | n/a |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 13982 | Additional Members: 12 | Rows returned: 4 |  | 
 
 |