| Compound Information | SONAR Target prediction |  | Name: | ESTRIOL |  | Unique Identifier: | SPE01500285  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 264.191 g/mol |  | X log p: | 6.586  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC12CCC3C(CCc4cc(O)ccc34)C1CC(O)C2O |  | Class: | sterol |  | Source: | mammalian hormone |  | Reference: | JACS 76:2943 (1954); Biochem Prep 12:81 (1968); J Steroid Biochem 20:945 (1984) |  | Therapeutics: | estrogen |  | Generic_name: | 1,3,5(10)-ESTRATRIENE-3,16,17-TRIOL |  | Chemical_iupac_name: | ESTRIOL |  | Drug_type: | Experimental |  | Kegg_compound_id: | C05141 |  | Drugbank_id: | EXPT01361 |  | Logp: | 2.337 |  | Cas_registry_number: | 50-27-1 |  | Drug_category: | Cytochrome P450 51 inhibitor |  | Organisms_affected: | -1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MCK1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5985±0.00869741 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9992±0.0115372 | 
	 
	
		| Z-Score: | 
		-0.0542±0.493891 | 
	 
	
		| p-Value: | 
		0.7273 | 
	 
	
		| Z-Factor: | 
		-17.1626 | 
	 
	
		| Fitness Defect: | 
		0.3184 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 12|A9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.50 Celcius |  | Date: | 2007-11-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.039425±0.00069 |  | Plate DMSO Control (-): | 0.5869500000000001±0.04242 |  | Plate Z-Factor: | 0.7698 |  
  |  png ps pdf |  
 
 
	
		| 5488457 | 
		n/a | 
	 
	
		| 6432479 | 
		(16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol | 
	 
	
		| 6604179 | 
		(8S,9S,13R,14R,16R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol | 
	 
	
		| 6918969 | 
		(8S,9R,13R,14S,16R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol | 
	 
	
		| 6927063 | 
		(8S,9R,13S,14S,16S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol | 
	 
	
		| 6955451 | 
		(8R,9R,13R,14S,16R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 13982 | Additional Members: 12 | Rows returned: 4 |  |   
 
 |