Compound Information | SONAR Target prediction | Name: | ESTRIOL | Unique Identifier: | SPE01500285 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 264.191 g/mol | X log p: | 6.586 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC12CCC3C(CCc4cc(O)ccc34)C1CC(O)C2O | Class: | sterol | Source: | mammalian hormone | Reference: | JACS 76:2943 (1954); Biochem Prep 12:81 (1968); J Steroid Biochem 20:945 (1984) | Therapeutics: | estrogen | Generic_name: | 1,3,5(10)-ESTRATRIENE-3,16,17-TRIOL | Chemical_iupac_name: | ESTRIOL | Drug_type: | Experimental | Kegg_compound_id: | C05141 | Drugbank_id: | EXPT01361 | Logp: | 2.337 | Cas_registry_number: | 50-27-1 | Drug_category: | Cytochrome P450 51 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
MMS22 |
Replicates: |
2 |
Raw OD Value: r im |
0.5112±0.0115966 |
Normalized OD Score: sc h |
1.0659±0.0132673 |
Z-Score: |
2.1845±0.349206 |
p-Value: |
0.033859 |
Z-Factor: |
-2.51733 |
Fitness Defect: |
3.3856 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 18|B6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.30 Celcius | Date: | 2008-06-13 YYYY-MM-DD | Plate CH Control (+): | 0.040475±0.00081 | Plate DMSO Control (-): | 0.486175±0.04309 | Plate Z-Factor: | 0.6996 |
| png ps pdf |
5488457 |
n/a |
6432479 |
(16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
6604179 |
(8S,9S,13R,14R,16R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol |
6918969 |
(8S,9R,13R,14S,16R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol |
6927063 |
(8S,9R,13S,14S,16S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol |
6955451 |
(8R,9R,13R,14S,16R,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-t riol |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 13982 | Additional Members: 12 | Rows returned: 4 | |
|