| Compound Information | SONAR Target prediction |
| Name: | ERGONOVINE MALEATE |
| Unique Identifier: | SPE01500277 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 415.271 g/mol |
| X log p: | 9.483 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 20.31 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | CC(CO)NC(=O)C1CN(C)C2Cc3cnc4cccc(C2=C1)c34.OC(=O)C=CC(O)=O |
| Class: | alkaloid |
| Source: | ergot and Convolvulvaceae spp |
| Therapeutics: | oxytocic, 5HT antagonist |