| Compound Information | SONAR Target prediction | | Name: | ERGOCALCIFEROL | | Unique Identifier: | SPE01500276 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 353.307 g/mol | | X log p: | 9.584 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C(CCCC12C)=CC=C1CC(O)CCC1=C | | Source: | irradiation of ergosterol | | Reference: | Steroids 1959:90; Prog Chem Org Nat Prod 27:131 (1969) | | Therapeutics: | antirachitic vitamin; LD50 (rat) 56 mg/kg po | | Generic_name: | Vitamin D2 (Ergocalciferol) | | Chemical_iupac_name: | 3-[2-[1-(5,6-dimethylhept-3-en-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-yli dene]ethylidene]-4-methylidene-cyclohexan-1-ol | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA449484 | | Kegg_compound_id: | C05441 | | Drugbank_id: | APRD00426 | | Melting_point: | 115.0-119.0 oC | | H2o_solubility: | Insoluble | | Logp: | 6.388 | | Cas_registry_number: | 50-14-6 | | Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C50146&Index=0&Type=Mass&Large=on | | Drug_category: | Antihypocalcemic Agents; Antihypoparathyroid Agents; Essential Vitamin; Vitamins (Vitamin D); ATC:A11CC01 | | Indication: | For the treament of vitamin D deficiency or insufficiency, refractory rickets (vitamin D resistant rickets), familial hypophosphatemia and hypoparathyroidism, and in the management of hypocalcemia and renal osteodystrophy in patients with chronic renal failure undergoing dialysis. Also used in conjunction with calcium in the management and prevention of primary or corticosteroid-induced osteoporosis. | | Pharmacology: | Used in the treatment of hypcalcemia and in dialysis-dependent renal failure. Ergoalcifediol (Vitamin D2) is a fat soluble steroid hormone precursor of vitamin D that contributes to the maintenance of normal levels of calcium and phosphorus in the bloodstream. | | Mechanism_of_action: | Vitamin D2 is the form of vitamin D most commonly added to foods and nutritional supplements. Vitamin D2 must be transformed (hydroxylated) into one of two active forms via the liver or kidney. Once transformed, it binds to the vitamin D receptor that then leads to a variety of regulatory roles. Vitamin D plays an important role in maintaining calcium balance and in the regulation of parathyroid hormone (PTH). It promotes renal reabsorption of calcium, increases intestinal absorption of calcium and phosphorus, and increases calcium and phosphorus mobilization from bone to plasma. Vitamin D2 and its analogs appear to promote intestinal absorption of calcium through binding to a specific receptor in the mucosal cytoplasm of the intestine. Subsequently, calcium is absorbed through formation of a calcium-binding protein. | | Organisms_affected: | Humans and other mammals |
| Species: |
4932 |
| Condition: |
SAM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6281±0.0125158 |
| Normalized OD Score: sc h |
0.9978±0.0246389 |
| Z-Score: |
-0.1028±1.24653 |
| p-Value: |
0.380602 |
| Z-Factor: |
-26.3339 |
| Fitness Defect: |
0.966 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 12|A4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.50 Celcius | | Date: | 2007-09-21 YYYY-MM-DD | | Plate CH Control (+): | 0.040725±0.00468 | | Plate DMSO Control (-): | 0.62695±0.02858 | | Plate Z-Factor: | 0.8441 |
| png ps pdf |
| 7092828 |
(1S)-3-[2-[(1R,3aS,7aS)-1-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-ind en-4-ylidene]ethylidene]-4-methylidene-cyclohexan-1-ol |
| 7251162 |
(1R,3E)-3-[(2E)-2-[(1S,3aR,7aS)-1-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydr o-1H-inden-4-ylidene]ethylidene]-4-methylidene-cyclohexan-1-ol |
| 7251163 |
(1R,3E)-3-[(2E)-2-[(1S,3aR,7aS)-1-[(E,2S,5S)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydr o-1H-inden-4-ylidene]ethylidene]-4-methylidene-cyclohexan-1-ol |
| 7251164 |
(1R,3E)-3-[(2E)-2-[(1S,3aR,7aS)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydr o-1H-inden-4-ylidene]ethylidene]-4-methylidene-cyclohexan-1-ol |
| 7251165 |
(1R,3E)-3-[(2E)-2-[(1S,3aR,7aS)-1-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydr o-1H-inden-4-ylidene]ethylidene]-4-methylidene-cyclohexan-1-ol |
| 16049531 |
(1S,3Z)-3-[(2E)-2-[(1R,3aR,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4 -ylidene]ethylidene]-4-methylidene-cyclohexan-1-ol; (1S,3Z)-3-[(2E)-2-[(1R,3aR,7aR)-1-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydr o-1H-inden-4-ylidene]ethylidene]-4-methylidene-cyclohexan-1-ol |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 5423 | Additional Members: 4 | Rows returned: 1 | |
|