Compound Information | SONAR Target prediction | Name: | ADRENALINE BITARTRATE | Unique Identifier: | SPE01500274 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 314.14 g/mol | X log p: | 6.314 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CNCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O | Class: | alkaloid | Source: | Portulaca grandiflora | Therapeutics: | adrenergic agonist, bronchodilator, antiglaucoma agent |
Species: |
4932 |
Condition: |
RNR3 |
Replicates: |
2 |
Raw OD Value: r im |
0.7755±0.00898026 |
Normalized OD Score: sc h |
0.9860±0.00762229 |
Z-Score: |
-0.4292±0.267195 |
p-Value: |
0.67328 |
Z-Factor: |
-5.34565 |
Fitness Defect: |
0.3956 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 12|A2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2006-04-26 YYYY-MM-DD | Plate CH Control (+): | 0.039874999999999994±0.00151 | Plate DMSO Control (-): | 0.7848250000000001±0.01204 | Plate Z-Factor: | 0.9484 |
| png ps pdf |
DBLink | Rows returned: 5 | |
5815 |
(2R,3R)-2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |
89249 |
(2R,3R)-2,3-dihydroxybutanedioic acid; 4-(1-hydroxy-2-methylamino-ethyl)benzene-1,2-diol |
5702049 |
2,3-dihydroxybutanedioic acid; 4-[(1S)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |
6604103 |
(2R,3S)-2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |
6852374 |
2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 1040 | Additional Members: 10 | Rows returned: 1 | |
|