| 
 | Compound Information | SONAR Target prediction |  | Name: | ADRENALINE BITARTRATE |  | Unique Identifier: | SPE01500274 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 314.14 g/mol |  | X log p: | 6.314  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CNCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O |  | Class: | alkaloid |  | Source: | Portulaca grandiflora |  | Therapeutics: | adrenergic agonist, bronchodilator, antiglaucoma agent | 
 
 
	
		| Species: | 4932 |  
		| Condition: | APC9 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6651±0.00579828 |  
		| Normalized OD Score: sc h | 0.9683±0.0180236 |  
		| Z-Score: | -1.7159±0.953279 |  
		| p-Value: | 0.157179 |  
		| Z-Factor: | -4.68678 |  
		| Fitness Defect: | 1.8504 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 12|A2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.20 Celcius |  | Date: | 2007-11-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.041625±0.00044 |  | Plate DMSO Control (-): | 0.68025±0.02074 |  | Plate Z-Factor: | 0.9006 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 5 |  | 
 
	
		| 5815 | (2R,3R)-2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |  
		| 89249 | (2R,3R)-2,3-dihydroxybutanedioic acid; 4-(1-hydroxy-2-methylamino-ethyl)benzene-1,2-diol |  
		| 5702049 | 2,3-dihydroxybutanedioic acid; 4-[(1S)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |  
		| 6604103 | (2R,3S)-2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |  
		| 6852374 | 2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |  
 | internal high similarity DBLink  | Rows returned: 5 |  | 
 
 | active | Cluster 1040 | Additional Members: 10 | Rows returned: 1 |  | 
 
 |