| 
 | Compound Information | SONAR Target prediction |  | Name: | ADRENALINE BITARTRATE |  | Unique Identifier: | SPE01500274 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 314.14 g/mol |  | X log p: | 6.314  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CNCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O |  | Class: | alkaloid |  | Source: | Portulaca grandiflora |  | Therapeutics: | adrenergic agonist, bronchodilator, antiglaucoma agent | 
 
 
	
		| Species: | 4932 |  
		| Condition: | pdr_yCG196 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7630±0.0212132 |  
		| Normalized OD Score: sc h | 1.0215±0.0309765 |  
		| Z-Score: | 0.7223±1.04147 |  
		| p-Value: | 0.566688 |  
		| Z-Factor: | -6.29358 |  
		| Fitness Defect: | 0.5679 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum_ED |  | Plate Number and Position: | 1|H9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 30.00 Celcius |  | Date: | 2010-08-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.0885±0.00760 |  | Plate DMSO Control (-): | 0.9339999999999999±0.01812 |  | Plate Z-Factor: | 0.9212 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 5 |  | 
 
	
		| 5815 | (2R,3R)-2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |  
		| 89249 | (2R,3R)-2,3-dihydroxybutanedioic acid; 4-(1-hydroxy-2-methylamino-ethyl)benzene-1,2-diol |  
		| 5702049 | 2,3-dihydroxybutanedioic acid; 4-[(1S)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |  
		| 6604103 | (2R,3S)-2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |  
		| 6852374 | 2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |  
 | internal high similarity DBLink  | Rows returned: 5 |  | 
 
 | active | Cluster 1040 | Additional Members: 10 | Rows returned: 1 |  | 
 
 |