Compound Information | SONAR Target prediction | Name: | DIOXYBENZONE | Unique Identifier: | SPE01500255 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 232.147 g/mol | X log p: | 15.527 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)c1ccccc1O | Source: | synthetic | Therapeutics: | ultraviolet screen |
Species: |
4932 |
Condition: |
BIM1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5746±0.00367696 |
Normalized OD Score: sc h |
0.8828±0.000872863 |
Z-Score: |
-6.0194±0.447692 |
p-Value: |
0.000000006008 |
Z-Factor: |
0.535163 |
Fitness Defect: |
18.9302 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 18|A3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.60 Celcius | Date: | 2008-06-24 YYYY-MM-DD | Plate CH Control (+): | 0.039825±0.00071 | Plate DMSO Control (-): | 0.64365±0.01060 | Plate Z-Factor: | 0.9434 |
| png ps pdf |
DBLink | Rows returned: 3 | |
8569 |
(2-hydroxy-4-methoxy-phenyl)-(2-hydroxyphenyl)methanone |
8570 |
bis(2-hydroxy-4-methoxy-phenyl)methanone |
81876 |
(2,4-dihydroxyphenyl)-(2-hydroxy-4-methoxy-phenyl)methanone |
internal high similarity DBLink | Rows returned: 3 | |
nonactive | Cluster 15651 | Additional Members: 8 | Rows returned: 3 | |
|