| 
 | Compound Information | SONAR Target prediction |  | Name: | DIOXYBENZONE |  | Unique Identifier: | SPE01500255 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 232.147 g/mol |  | X log p: | 15.527  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)c1ccccc1O |  | Source: | synthetic |  | Therapeutics: | ultraviolet screen | 
 
 
	
		| Species: | 4932 |  
		| Condition: | MCK1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5272±0.0142128 |  
		| Normalized OD Score: sc h | 0.8739±0.0274406 |  
		| Z-Score: | -5.3244±0.747834 |  
		| p-Value: | 0.000000813424 |  
		| Z-Factor: | -12.9347 |  
		| Fitness Defect: | 14.022 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 11|G8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.50 Celcius |  | Date: | 2007-11-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.040825±0.00210 |  | Plate DMSO Control (-): | 0.587575±0.14567 |  | Plate Z-Factor: | 0.1306 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 3 |  | 
 
	
		| 8569 | (2-hydroxy-4-methoxy-phenyl)-(2-hydroxyphenyl)methanone |  
		| 8570 | bis(2-hydroxy-4-methoxy-phenyl)methanone |  
		| 81876 | (2,4-dihydroxyphenyl)-(2-hydroxy-4-methoxy-phenyl)methanone |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 15651 | Additional Members: 8 | Rows returned: 2 |  | 
 
 |