| Compound Information | SONAR Target prediction |  | Name: | DIOXYBENZONE |  | Unique Identifier: | SPE01500255  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 232.147 g/mol |  | X log p: | 15.527  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)c1ccccc1O |  | Source: | synthetic |  | Therapeutics: | ultraviolet screen |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE00100528 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7272±0 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9936±0 | 
	 
	
		| Z-Score: | 
		-0.2718±0 | 
	 
	
		| p-Value: | 
		0.78577 | 
	 
	
		| Z-Factor: | 
		-10.5339 | 
	 
	
		| Fitness Defect: | 
		0.2411 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|G10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2006-08-13 YYYY-MM-DD |  | Plate CH Control (+): | 0.0411±0.00056 |  | Plate DMSO Control (-): | 0.7175±0.02201 |  | Plate Z-Factor: | 0.9001 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 8569 | 
		(2-hydroxy-4-methoxy-phenyl)-(2-hydroxyphenyl)methanone | 
	 
	
		| 8570 | 
		bis(2-hydroxy-4-methoxy-phenyl)methanone | 
	 
	
		| 81876 | 
		(2,4-dihydroxyphenyl)-(2-hydroxy-4-methoxy-phenyl)methanone | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 15651 | Additional Members: 8 | Rows returned: 2 |  |   
 
 |