Compound Information | SONAR Target prediction | Name: | DIOXYBENZONE | Unique Identifier: | SPE01500255 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 232.147 g/mol | X log p: | 15.527 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)c1ccccc1O | Source: | synthetic | Therapeutics: | ultraviolet screen |
Species: |
4932 |
Condition: |
SPE00100009 |
Replicates: |
2 |
Raw OD Value: r im |
0.0465±0.00226274 |
Normalized OD Score: sc h |
1.0010±0.0441421 |
Z-Score: |
0.0158±0.601349 |
p-Value: |
0.670716 |
Z-Factor: |
-2.84485 |
Fitness Defect: |
0.3994 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|G10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.50 Celcius | Date: | 2006-11-29 YYYY-MM-DD | Plate CH Control (+): | 0.0398±0.00095 | Plate DMSO Control (-): | 0.049525±0.27622 | Plate Z-Factor: | -2.6520 |
| png ps pdf |
DBLink | Rows returned: 3 | |
8569 |
(2-hydroxy-4-methoxy-phenyl)-(2-hydroxyphenyl)methanone |
8570 |
bis(2-hydroxy-4-methoxy-phenyl)methanone |
81876 |
(2,4-dihydroxyphenyl)-(2-hydroxy-4-methoxy-phenyl)methanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 15651 | Additional Members: 8 | Rows returned: 2 | |
|