Compound Information | SONAR Target prediction | Name: | DIOXYBENZONE | Unique Identifier: | SPE01500255 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 232.147 g/mol | X log p: | 15.527 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)c1ccccc1O | Source: | synthetic | Therapeutics: | ultraviolet screen |
Species: |
4932 |
Condition: |
HOG1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6365±0.0502046 |
Normalized OD Score: sc h |
0.9074±0.00489799 |
Z-Score: |
-2.5410±0.289897 |
p-Value: |
0.0127614 |
Z-Factor: |
0.314207 |
Fitness Defect: |
4.3613 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 2|F8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09325±0.00621 | Plate DMSO Control (-): | 0.85275±0.01400 | Plate Z-Factor: | 0.9182 |
| png ps pdf |
DBLink | Rows returned: 3 | |
8569 |
(2-hydroxy-4-methoxy-phenyl)-(2-hydroxyphenyl)methanone |
8570 |
bis(2-hydroxy-4-methoxy-phenyl)methanone |
81876 |
(2,4-dihydroxyphenyl)-(2-hydroxy-4-methoxy-phenyl)methanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 15651 | Additional Members: 8 | Rows returned: 2 | |
|