| Compound Information | SONAR Target prediction |  | Name: | DEXAMETHASONE ACETATE |  | Unique Identifier: | SPE01500231  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 404.26 g/mol |  | X log p: | 4.126  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)COC(C)=O |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid, antiinflammatory |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SRS2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6884±0.00473762 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9770±0.0000337199 | 
	 
	
		| Z-Score: | 
		-1.1223±0.014755 | 
	 
	
		| p-Value: | 
		0.261746 | 
	 
	
		| Z-Factor: | 
		-2.08978 | 
	 
	
		| Fitness Defect: | 
		1.3404 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 3|H4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 20.70 Celcius |  | Date: | 2008-01-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.041725±0.00045 |  | Plate DMSO Control (-): | 0.68265±0.01665 |  | Plate Z-Factor: | 0.9201 |  
  |  png ps pdf |  
 
 
	
		| 3680 | 
		[2-(9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenant hren-17-yl)-2-oxo-ethyl] acetate | 
	 
	
		| 9563 | 
		[2-[(9R,11S)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]ph enanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 13802 | 
		[2-[(9R,11S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydr ocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 27485 | 
		[1-(9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren -17-yl)-1-oxo-propan-2-yl] acetate | 
	 
	
		| 66257 | 
		[(2S)-1-[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16- octahydrocyclopenta[a]phenanthren-17-yl]-1-oxo-propan-2-yl] acetate | 
	 
	
		| 122054 | 
		[2-[(8S,9R,10S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-o ctahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 4 |  |   
 |  active | Cluster 1865 | Additional Members: 13 | Rows returned: 3 |  |   
 
 |