| 
 | Compound Information | SONAR Target prediction |  | Name: | DEXAMETHASONE ACETATE |  | Unique Identifier: | SPE01500231 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 404.26 g/mol |  | X log p: | 4.126  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)COC(C)=O |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid, antiinflammatory | 
 
 
	
		| Species: | 4932 |  
		| Condition: | ARC18 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6536±0.00339411 |  
		| Normalized OD Score: sc h | 0.9798±0.0013699 |  
		| Z-Score: | -0.9143±0.0798458 |  
		| p-Value: | 0.361326 |  
		| Z-Factor: | -4.34357 |  
		| Fitness Defect: | 1.018 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 3|H4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.90 Celcius |  | Date: | 2008-02-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.041825±0.00091 |  | Plate DMSO Control (-): | 0.6515±0.01885 |  | Plate Z-Factor: | 0.8902 | 
 |  png ps
 pdf
 | 
 
 
	
		| 3680 | [2-(9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenant hren-17-yl)-2-oxo-ethyl] acetate
 |  
		| 9563 | [2-[(9R,11S)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]ph enanthren-17-yl]-2-oxo-ethyl] acetate
 |  
		| 13802 | [2-[(9R,11S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydr ocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
		| 27485 | [1-(9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren -17-yl)-1-oxo-propan-2-yl] acetate
 |  
		| 66257 | [(2S)-1-[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16- octahydrocyclopenta[a]phenanthren-17-yl]-1-oxo-propan-2-yl] acetate
 |  
		| 122054 | [2-[(8S,9R,10S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-o ctahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 4 |  | 
 
 | active | Cluster 1865 | Additional Members: 13 | Rows returned: 3 |  | 
 
 |