Compound Information | SONAR Target prediction | Name: | DEXAMETHASONE ACETATE | Unique Identifier: | SPE01500231 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 404.26 g/mol | X log p: | 4.126 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)COC(C)=O | Source: | semisynthetic | Therapeutics: | glucocorticoid, antiinflammatory |
Species: |
4932 |
Condition: |
PFK2 |
Replicates: |
2 |
Raw OD Value: r im |
0.4625±0.0111016 |
Normalized OD Score: sc h |
0.9580±0.0169838 |
Z-Score: |
-1.3486±0.525373 |
p-Value: |
0.206958 |
Z-Factor: |
-1.58848 |
Fitness Defect: |
1.5752 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 3|H4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.70 Celcius | Date: | 2008-05-10 YYYY-MM-DD | Plate CH Control (+): | 0.0404±0.00068 | Plate DMSO Control (-): | 0.47450000000000003±0.00969 | Plate Z-Factor: | 0.9272 |
| png ps pdf |
6604241 |
[2-[(8R,9S,10S,11S,13S,14R,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octah ydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
6604290 |
[2-[(8R,9S,10S,11S,13S,14R,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15, 16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061381 |
[2-[(8S,9R,10S,11R,13S,14R,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15, 16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061382 |
[2-[(8S,9R,10S,11R,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15, 16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061383 |
[2-[(8S,9R,10S,11S,13S,14R,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15, 16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 1865 | Additional Members: 13 | Rows returned: 3 | |
|