| Compound Information | SONAR Target prediction | | Name: | DEXAMETHASONE ACETATE | | Unique Identifier: | SPE01500231 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 404.26 g/mol | | X log p: | 4.126 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)COC(C)=O | | Source: | semisynthetic | | Therapeutics: | glucocorticoid, antiinflammatory |
| Species: |
4932 |
| Condition: |
PEX11 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6822±0.00784888 |
| Normalized OD Score: sc h |
0.9993±0.00574 |
| Z-Score: |
-0.0530±0.339016 |
| p-Value: |
0.810808 |
| Z-Factor: |
-9.18865 |
| Fitness Defect: |
0.2097 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 11|E9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.20 Celcius | | Date: | 2007-10-23 YYYY-MM-DD | | Plate CH Control (+): | 0.038875±0.00038 | | Plate DMSO Control (-): | 0.66675±0.16869 | | Plate Z-Factor: | 0.1196 |
|  png
ps
pdf |
| 6604241 |
[2-[(8R,9S,10S,11S,13S,14R,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octah
ydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 6604290 |
[2-[(8R,9S,10S,11S,13S,14R,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,
16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 7061381 |
[2-[(8S,9R,10S,11R,13S,14R,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,
16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 7061382 |
[2-[(8S,9R,10S,11R,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,
16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| 7061383 |
[2-[(8S,9R,10S,11S,13S,14R,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,
16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 1865 | Additional Members: 13 | Rows returned: 3 | |
|
