| 
 | Compound Information | SONAR Target prediction |  | Name: | DEXAMETHASONE ACETATE |  | Unique Identifier: | SPE01500231 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 404.26 g/mol |  | X log p: | 4.126  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)COC(C)=O |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid, antiinflammatory | 
 
 
	
		| Species: | 4932 |  
		| Condition: | AAT2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7110±0.0104652 |  
		| Normalized OD Score: sc h | 0.9787±0.000735724 |  
		| Z-Score: | -1.1331±0.0642539 |  
		| p-Value: | 0.257678 |  
		| Z-Factor: | -1.58027 |  
		| Fitness Defect: | 1.356 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 3|H4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.50 Celcius |  | Date: | 2008-04-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.039724999999999996±0.00061 |  | Plate DMSO Control (-): | 0.71515±0.01123 |  | Plate Z-Factor: | 0.9461 | 
 |  png ps
 pdf
 | 
 
 
	
		| 499988 | [2-(9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren -17-yl)-2-oxo-ethyl] acetate
 |  
		| 656823 | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15, 16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate hydrate
 |  
		| 1150657 | [2-[(8R,9S,10R,11R,13R,14R,16S,17S)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15, 16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
		| 5284539 | [2-[(8S,9R,10S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-o ctahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
		| 5702036 | [2-[(9R,10S,11S,13S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octa hydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
		| 6551035 | [2-[(8R,9S,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15, 16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 4 |  | 
 
 | active | Cluster 1865 | Additional Members: 13 | Rows returned: 3 |  | 
 
 |