| Compound Information | SONAR Target prediction |  | Name: | DEXAMETHASONE ACETATE |  | Unique Identifier: | SPE01500231  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 404.26 g/mol |  | X log p: | 4.126  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)COC(C)=O |  | Source: | semisynthetic |  | Therapeutics: | glucocorticoid, antiinflammatory |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPO22 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.3582±0.0118087 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9905±0.0104368 | 
	 
	
		| Z-Score: | 
		-0.1178±0.129606 | 
	 
	
		| p-Value: | 
		0.906598 | 
	 
	
		| Z-Factor: | 
		-44.3064 | 
	 
	
		| Fitness Defect: | 
		0.0981 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 11|E9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2006-05-12 YYYY-MM-DD |  | Plate CH Control (+): | 0.038625±0.00066 |  | Plate DMSO Control (-): | 0.3326±0.02067 |  | Plate Z-Factor: | 0.8495 |  
  |  png ps pdf |  
 
 
	
		| 224246 | 
		[2-[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octah ydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 236702 | 
		[2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15, 16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 247935 | 
		[2-[(6S,8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-6,7,8,11,12,14,15,16 -octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 249434 | 
		[1-[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octah ydrocyclopenta[a]phenanthren-17-yl]-1-oxo-propan-2-yl] acetate | 
	 
	
		| 443967 | 
		[2-[(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15, 16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 494005 | 
		[2-(9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanth ren-17-yl)-2-oxo-ethyl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 4 |  |   
 |  active | Cluster 1865 | Additional Members: 13 | Rows returned: 3 |  |   
 
 |