| Compound Information | SONAR Target prediction |  | Name: | SODIUM DEHYDROCHOLATE |  | Unique Identifier: | SPE01500225  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 392.251 g/mol |  | X log p: | -1.652  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 91.34 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | [Na+].[O-]C(=O)CCC(C)C1CCC2C3C(CC(=O)C12C)C1(C)CCC(=O)CC1CC3=O |  | Source: | semisynthetic |  | Therapeutics: | choleretic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RPN1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6424±0.0123744 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9882±0.0092571 | 
	 
	
		| Z-Score: | 
		-0.6020±0.461149 | 
	 
	
		| p-Value: | 
		0.567958 | 
	 
	
		| Z-Factor: | 
		-8.06055 | 
	 
	
		| Fitness Defect: | 
		0.5657 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 3|H2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.40 Celcius |  | Date: | 2008-05-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.04025±0.00072 |  | Plate DMSO Control (-): | 0.64465±0.01465 |  | Plate Z-Factor: | 0.9232 |  
  |  png ps pdf |  
 
 
	
		| 2974 | 
		4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)p entanoate | 
	 
	
		| 2975 | 
		4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)p entanoic acid | 
	 
	
		| 6674 | 
		(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoic acid | 
	 
	
		| 8957 | 
		sodium 4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)p entanoate | 
	 
	
		| 94192 | 
		(4R)-4-[(5S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H -cyclopenta[a]phenanthren-17-yl]pentanoic acid | 
	 
	
		| 111335 | 
		(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoate; magnesium(+2) cation | 
	 
 
 | internal high similarity DBLink  | Rows returned: 35 | 1 2 3 4 5 6 Next >>  |   
 |  active | Cluster 7145 | Additional Members: 4 | Rows returned: 0 |  |  
  
 |