| Compound Information | SONAR Target prediction | | Name: | SODIUM DEHYDROCHOLATE | | Unique Identifier: | SPE01500225 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 392.251 g/mol | | X log p: | -1.652 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 91.34 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | [Na+].[O-]C(=O)CCC(C)C1CCC2C3C(CC(=O)C12C)C1(C)CCC(=O)CC1CC3=O | | Source: | semisynthetic | | Therapeutics: | choleretic |
| Species: |
4932 |
| Condition: |
SAM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6501±0.00381838 |
| Normalized OD Score: sc h |
0.9979±0.0102745 |
| Z-Score: |
-0.1109±0.52239 |
| p-Value: |
0.713528 |
| Z-Factor: |
-9.38287 |
| Fitness Defect: |
0.3375 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 11|E6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.50 Celcius | | Date: | 2007-09-21 YYYY-MM-DD | | Plate CH Control (+): | 0.039975±0.00064 | | Plate DMSO Control (-): | 0.6449±0.16628 | | Plate Z-Factor: | 0.0933 |
| png ps pdf |
| 2974 |
4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)p entanoate |
| 2975 |
4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)p entanoic acid |
| 6674 |
(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 8957 |
sodium 4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)p entanoate |
| 94192 |
(4R)-4-[(5S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H -cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 111335 |
(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoate; magnesium(+2) cation |
| internal high similarity DBLink | Rows returned: 35 | 1 2 3 4 5 6 Next >> |
| active | Cluster 7145 | Additional Members: 4 | Rows returned: 0 | |
|