| Compound Information | SONAR Target prediction |
| Name: | DAPSONE |
| Unique Identifier: | SPE01500222 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 236.207 g/mol |
| X log p: | 14.532 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 42.52 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | Nc1ccc(cc1)S(=O)(=O)c1ccc(N)cc1 |
| Source: | synthetic |
| Therapeutics: | antibacterial, leprostatic, dermatitis herpetiformis suppressant |
| Generic_name: | Dapsone |
| Chemical_iupac_name: | 4-(4-aminophenyl)sulfonylaniline |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA449211 |
| Kegg_compound_id: | C07666 |
| Drugbank_id: | APRD00345 |
| Melting_point: | 175.5 oC |
| H2o_solubility: | 380 mg/L |
| Logp: | 1.304 |
| Isoelectric_point: | 2.41 |
| Cas_registry_number: | 80-08-0 |
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C80080&Index=0&Type=Mass&Large=on |
| Drug_category: | Leprostatic Agents; Antimalarials; Anti-inflammatory Agents; Anti-Infectives; Antimycobacterials; ATC:J04BA02 |
| Indication: | For the treatment and management of Leprosy and Dermatitis Herpetiformis |
| Pharmacology: | Dapsone is a sulfone with anti-inflammatory immunosuppressive properties as well as antibacterial and antibiotic properties. Dapsone is the principal drug in a multidrug regimen recommended by the World Health Organization for the treatment of leprosy. As an anti-infective agent, it is also used for treating malaria and, recently, for Pneumocystic carinii pneumonia in AIDS patients. Dapsone is absorbed rapidly and nearly completely from the gastrointestinal tract. Dapsone is distributed throughout total body water and is present in all tissues. However, it tends to be retained in skin and muscle and especially in the liver and kidney: traces of the drug are present in these organs up to 3 weeks after therapy cessation. |
| Mechanism_of_action: | Dapsone acts against bacteria and protozoa in the same way as sulphonamides, that is by inhibiting the synthesis of dihydrofolic acid through competition with para-amino-benzoate for the active site of dihydropteroate synthetase. The anti-inflammatory action of the drug is unrelated to its antibacterial action and is still not fully understood. |
| Organisms_affected: | Mycobacteria |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 171 172 173 174 175 176 177 178 179 180 Next >> [205] |
| Species: | 4932 |
| Condition: | SAM2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6515±0.000353553 |
| Normalized OD Score: sc h | 1.0023±0.000589327 |
| Z-Score: | 0.1147±0.0279302 |
| p-Value: | 0.908692 |
| Z-Factor: | -8.47326 |
| Fitness Defect: | 0.0957 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 2 |
| 2955 | 4-(4-aminophenyl)sulfonylaniline |
| 516666 | 4-(benzenesulfonyl)aniline |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 8643 | Additional Members: 6 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory